C23H28O7S — CID 10411383
(3R,5R,7S)-7-acetyloxy-9-(benzenesulfinyl)-3,5-dihydroxy-9-phenylnonanoic acid (PubChem CID 10411383) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is (3R,5R,7S)-7-acetyloxy-9-(benzenesulfinyl)-3,5-dihydroxy-9-phenylnonanoic acid.
| Compound Name | (3R,5R,7S)-7-acetyloxy-9-(benzenesulfinyl)-3,5-dihydroxy-9-phenylnonanoic acid |
|---|---|
| PubChem CID | 10411383 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (3R,5R,7S)-7-acetyloxy-9-(benzenesulfinyl)-3,5-dihydroxy-9-phenylnonanoic acid |
| SMILES | CC(=O)O[C@H](CC(c1ccccc1)S(=O)c1ccccc1)C[C@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C23H28O7S/c1-16(24)30-20(13-18(25)12-19(26)14-23(27)28)15-22(17-8-4-2-5-9-17)31(29)21-10-6-3-7-11-21/h2-11,18-20,22,25-26H,12-15H2,1H3,(H,27,28)/t18-,19-,20+,22?,31?/m1/s1 |
| InChIKey | NDVAZHKGFZSBJL-ZLBIGRAXSA-N |
| XLogP | 2.83 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |