About ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate
ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate (PubChem CID 10411679) has the molecular formula C19H16Cl2N2O5S
and a molecular weight of 455.32 g/mol. Its IUPAC name is ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate |
| PubChem CID | 10411679 |
| Molecular Formula | C19H16Cl2N2O5S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate |
| SMILES | CCOC(=O)C(C#N)C(=O)c1ccccc1S(=O)(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O5S/c1-2-28-19(25)15(10-22)18(24)14-5-3-4-6-17(14)29(26,27)23-11-12-7-8-13(20)9-16(12)21/h3-9,15,23H,2,11H2,1H3 |
| InChIKey | CMUBGLVQTCCCJZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate?
The IUPAC name of ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate (CID 10411679) is ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate.
What is the SMILES notation for ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate?
The canonical SMILES for ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate is CCOC(=O)C(C#N)C(=O)c1ccccc1S(=O)(=O)NCc1ccc(Cl)cc1Cl.
What is the InChIKey of ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate?
The InChIKey is CMUBGLVQTCCCJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16Cl2N2O5S/c1-2-28-19(25)15(10-22)18(24)14-5-3-4-6-17(14)29(26,27)23-11-12-7-8-13(20)9-16(12)21/h3-9,15,23H,2,11H2,1H3.
What are the key properties of ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate?
ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate has a molecular weight of 455.32 g/mol, XLogP of 3.36, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-cyano-3-[2-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]-3-oxopropanoate is sourced from PubChem (CID 10411679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).