C31H54O2 — CID 10411861
(3R,4S,5S,8S,9S,10R,13R,14S,17R)-4-[(E)-4-hydroxybut-2-enyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 10411861) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is (3R,4S,5S,8S,9S,10R,13R,14S,17R)-4-[(E)-4-hydroxybut-2-enyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,4S,5S,8S,9S,10R,13R,14S,17R)-4-[(E)-4-hydroxybut-2-enyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 10411861 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | (3R,4S,5S,8S,9S,10R,13R,14S,17R)-4-[(E)-4-hydroxybut-2-enyl]-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4[C@H](C/C=C/CO)[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H54O2/c1-21(2)9-8-10-22(3)25-14-15-26-23-12-13-27-24(11-6-7-20-32)29(33)17-19-31(27,5)28(23)16-18-30(25,26)4/h6-7,21-29,32-33H,8-20H2,1-5H3/b7-6+/t22-,23+,24+,25-,26+,27+,28+,29-,30-,31+/m1/s1 |
| InChIKey | JOWMRCJWGKGHHQ-UFLBLYHPSA-N |
| XLogP | 7.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|