C19H20F3N3O5S — CID 10411874
N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide (PubChem CID 10411874) has the molecular formula C19H20F3N3O5S and a molecular weight of 459.45 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10411874 |
| Molecular Formula | C19H20F3N3O5S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)F)cn3)cc2)CCOCC1 |
| InChI | InChI=1S/C19H20F3N3O5S/c20-19(21,22)6-5-14-11-24-16(12-23-14)13-1-3-15(4-2-13)31(28,29)18(17(26)25-27)7-9-30-10-8-18/h1-4,11-12,27H,5-10H2,(H,25,26) |
| InChIKey | UPUZDXUEUACXSU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|