C19H26F3N3O5S — CID 10412169
N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 10412169) has the molecular formula C19H26F3N3O5S and a molecular weight of 465.49 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 10412169 |
| Molecular Formula | C19H26F3N3O5S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H26F3N3O5S/c20-19(21,22)6-3-14-1-2-16(23-13-14)15-4-9-25(10-5-15)31(28,29)18(17(26)24-27)7-11-30-12-8-18/h1-2,13,15,27H,3-12H2,(H,24,26) |
| InChIKey | WTQKQUUDAKFKPJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|