C25H27N3O6 — CID 10412172
6-[3-(diethylamino)propyl]-2,3-dimethoxy-8-nitroindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 10412172) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 6-[3-(diethylamino)propyl]-2,3-dimethoxy-8-nitroindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[3-(diethylamino)propyl]-2,3-dimethoxy-8-nitroindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 10412172 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 6-[3-(diethylamino)propyl]-2,3-dimethoxy-8-nitroindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CCN(CC)CCCn1c2c(c3cc(OC)c(OC)cc3c1=O)C(=O)c1ccc([N+](=O)[O-])cc1-2 |
| InChI | InChI=1S/C25H27N3O6/c1-5-26(6-2)10-7-11-27-23-18-12-15(28(31)32)8-9-16(18)24(29)22(23)17-13-20(33-3)21(34-4)14-19(17)25(27)30/h8-9,12-14H,5-7,10-11H2,1-4H3 |
| InChIKey | DELKZYCROIYJGT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 103.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|