About 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol
5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol (PubChem CID 10412249) has the molecular formula C30H30N2O3
and a molecular weight of 466.58 g/mol. Its IUPAC name is 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol.
Molecular Properties
| Compound Name | 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol |
| PubChem CID | 10412249 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol |
| SMILES | Oc1ccc2c(c1)CN(c1ccc(OCCN3CCCCC3)cc1)c1c-2ccc2cc(O)ccc12 |
| InChI | InChI=1S/C30H30N2O3/c33-24-8-13-28-21(18-24)4-11-29-27-12-7-25(34)19-22(27)20-32(30(28)29)23-5-9-26(10-6-23)35-17-16-31-14-2-1-3-15-31/h4-13,18-19,33-34H,1-3,14-17,20H2 |
| InChIKey | WDHIYKZHKBKYCY-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol?
The IUPAC name of 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol (CID 10412249) is 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol.
What is the SMILES notation for 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol?
The canonical SMILES for 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol is Oc1ccc2c(c1)CN(c1ccc(OCCN3CCCCC3)cc1)c1c-2ccc2cc(O)ccc12.
What is the InChIKey of 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol?
The InChIKey is WDHIYKZHKBKYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30N2O3/c33-24-8-13-28-21(18-24)4-11-29-27-12-7-25(34)19-22(27)20-32(30(28)29)23-5-9-26(10-6-23)35-17-16-31-14-2-1-3-15-31/h4-13,18-19,33-34H,1-3,14-17,20H2.
What are the key properties of 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol?
5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol has a molecular weight of 466.58 g/mol, XLogP of 6.43, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(2-piperidin-1-ylethoxy)phenyl]-6H-benzo[c]phenanthridine-2,8-diol is sourced from PubChem (CID 10412249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).