C25H39FN2O5 — CID 10412252
tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-(4-fluorophenoxy)heptanoate (PubChem CID 10412252) has the molecular formula C25H39FN2O5 and a molecular weight of 466.59 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-(4-fluorophenoxy)heptanoate.
| Compound Name | tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-(4-fluorophenoxy)heptanoate |
|---|---|
| PubChem CID | 10412252 |
| Molecular Formula | C25H39FN2O5 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | tert-butyl (3R)-3-[[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]carbamoyl]-7-(4-fluorophenoxy)heptanoate |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CCCCOc1ccc(F)cc1)CC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H39FN2O5/c1-24(2,3)21(23(31)27-7)28-22(30)17(16-20(29)33-25(4,5)6)10-8-9-15-32-19-13-11-18(26)12-14-19/h11-14,17,21H,8-10,15-16H2,1-7H3,(H,27,31)(H,28,30)/t17-,21-/m1/s1 |
| InChIKey | RTVOXABGYKGVKE-DYESRHJHSA-N |
| XLogP | 4.00 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|