C27H19NO7 — CID 10412375
7,17-dihydroxy-12-(4-hydroxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one (PubChem CID 10412375) has the molecular formula C27H19NO7 and a molecular weight of 469.45 g/mol. Its IUPAC name is 7,17-dihydroxy-12-(4-hydroxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one.
| Compound Name | 7,17-dihydroxy-12-(4-hydroxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
|---|---|
| PubChem CID | 10412375 |
| Molecular Formula | C27H19NO7 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 7,17-dihydroxy-12-(4-hydroxyphenyl)-8,16-dimethoxy-4-oxa-1-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-2(11),5,7,9,12,14,16,18,20-nonaen-3-one |
| SMILES | COc1cc2c(cc1O)oc(=O)c1c2c(-c2ccc(O)cc2)c2c3cc(OC)c(O)cc3ccn21 |
| InChI | InChI=1S/C27H19NO7/c1-33-21-10-16-14(9-18(21)30)7-8-28-25(16)23(13-3-5-15(29)6-4-13)24-17-11-22(34-2)19(31)12-20(17)35-27(32)26(24)28/h3-12,29-31H,1-2H3 |
| InChIKey | HHQABYRASKFSKG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|