C29H23FO3S — CID 10412435
2-[4-[(Z)-3-(4-fluorophenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid (PubChem CID 10412435) has the molecular formula C29H23FO3S and a molecular weight of 470.57 g/mol. Its IUPAC name is 2-[4-[(Z)-3-(4-fluorophenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-3-(4-fluorophenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid |
|---|---|
| PubChem CID | 10412435 |
| Molecular Formula | C29H23FO3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[4-[(Z)-3-(4-fluorophenyl)-3-(4-phenylphenyl)prop-2-enyl]sulfanylphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(SC/C=C(\c2ccc(F)cc2)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H23FO3S/c30-25-12-10-24(11-13-25)28(23-8-6-22(7-9-23)21-4-2-1-3-5-21)18-19-34-27-16-14-26(15-17-27)33-20-29(31)32/h1-18H,19-20H2,(H,31,32)/b28-18- |
| InChIKey | FZOMQZVNHPBILL-VEILYXNESA-N |
| XLogP | 7.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |