C26H29N7S — CID 10412503
5-[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N,4-dimethyl-1,3-thiazol-2-amine (PubChem CID 10412503) has the molecular formula C26H29N7S and a molecular weight of 471.63 g/mol. Its IUPAC name is 5-[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N,4-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N,4-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10412503 |
| Molecular Formula | C26H29N7S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 5-[2-[4-(4-benzylpiperazin-1-yl)anilino]pyrimidin-4-yl]-N,4-dimethyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(Cc5ccccc5)CC4)cc3)n2)s1 |
| InChI | InChI=1S/C26H29N7S/c1-19-24(34-26(27-2)29-19)23-12-13-28-25(31-23)30-21-8-10-22(11-9-21)33-16-14-32(15-17-33)18-20-6-4-3-5-7-20/h3-13H,14-18H2,1-2H3,(H,27,29)(H,28,30,31) |
| InChIKey | IVJHDSQPCKCYIW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|