C30H51FOSi — CID 10412645
(6E,10Z,14Z)-10-fluoro-2,6,11,14,17,17-hexamethyl-21-trimethylsilylhenicosa-1,6,10,14-tetraen-19-yn-3-ol (PubChem CID 10412645) has the molecular formula C30H51FOSi and a molecular weight of 474.82 g/mol. Its IUPAC name is (6E,10Z,14Z)-10-fluoro-2,6,11,14,17,17-hexamethyl-21-trimethylsilylhenicosa-1,6,10,14-tetraen-19-yn-3-ol.
| Compound Name | (6E,10Z,14Z)-10-fluoro-2,6,11,14,17,17-hexamethyl-21-trimethylsilylhenicosa-1,6,10,14-tetraen-19-yn-3-ol |
|---|---|
| PubChem CID | 10412645 |
| Molecular Formula | C30H51FOSi |
| Molecular Weight | 474.82 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | (6E,10Z,14Z)-10-fluoro-2,6,11,14,17,17-hexamethyl-21-trimethylsilylhenicosa-1,6,10,14-tetraen-19-yn-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C/CC/C(F)=C(\C)CC/C(C)=C\CC(C)(C)CC#CC[Si](C)(C)C |
| InChI | InChI=1S/C30H51FOSi/c1-24(2)29(32)19-17-25(3)14-13-15-28(31)27(5)18-16-26(4)20-22-30(6,7)21-11-12-23-33(8,9)10/h14,20,29,32H,1,13,15-19,21-23H2,2-10H3/b25-14+,26-20-,28-27- |
| InChIKey | AZQBUZAFZPWCJK-GDDBSIPBSA-N |
| XLogP | 9.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.82 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|