C26H45NO3Si2 — CID 10412681
(3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enylpyrrolidin-2-one (PubChem CID 10412681) has the molecular formula C26H45NO3Si2 and a molecular weight of 475.82 g/mol. Its IUPAC name is (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10412681 |
| Molecular Formula | C26H45NO3Si2 |
| Molecular Weight | 475.82 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | (3R,4S,5R)-1-benzyl-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H45NO3Si2/c1-12-16-21-22(29-31(8,9)25(2,3)4)23(30-32(10,11)26(5,6)7)24(28)27(21)19-20-17-14-13-15-18-20/h12-15,17-18,21-23H,1,16,19H2,2-11H3/t21-,22+,23-/m1/s1 |
| InChIKey | CLPKLMADLWXTNY-XPWALMASSA-N |
| XLogP | 6.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|