C21H11F4N3O4S — CID 10412732
6-fluoro-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone (PubChem CID 10412732) has the molecular formula C21H11F4N3O4S and a molecular weight of 477.40 g/mol. Its IUPAC name is 6-fluoro-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone.
| Compound Name | 6-fluoro-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
|---|---|
| PubChem CID | 10412732 |
| Molecular Formula | C21H11F4N3O4S |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 6-fluoro-2-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]spiro[isoquinoline-4,3'-pyrrolidine]-1,2',3,5'-tetrone |
| SMILES | O=C1CC2(C(=O)N1)C(=O)N(Cc1nc3cc(C(F)(F)F)ccc3s1)C(=O)c1ccc(F)cc12 |
| InChI | InChI=1S/C21H11F4N3O4S/c22-10-2-3-11-12(6-10)20(7-15(29)27-18(20)31)19(32)28(17(11)30)8-16-26-13-5-9(21(23,24)25)1-4-14(13)33-16/h1-6H,7-8H2,(H,27,29,31) |
| InChIKey | GSAJQGVLZBMWHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|