C26H38O8 — CID 10412786
[(1S,2R,8R,10E,14S,15R)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] butanoate (PubChem CID 10412786) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is [(1S,2R,8R,10E,14S,15R)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] butanoate.
| Compound Name | [(1S,2R,8R,10E,14S,15R)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] butanoate |
|---|---|
| PubChem CID | 10412786 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [(1S,2R,8R,10E,14S,15R)-2-acetyloxy-8-hydroxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] butanoate |
| SMILES | CCCC(=O)OC1C2=C(C)C(=O)O[C@]2(O)C/C(C)=C/CC[C@H](C)[C@H]2CC[C@](C)(O2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H38O8/c1-7-9-20(28)32-22-21-17(4)24(29)34-26(21,30)14-15(2)10-8-11-16(3)19-12-13-25(6,33-19)23(22)31-18(5)27/h10,16,19,22-23,30H,7-9,11-14H2,1-6H3/b15-10+/t16-,19+,22?,23+,25-,26+/m0/s1 |
| InChIKey | VJBRDORLUIZCKL-JZYRCWKISA-N |
| XLogP | 3.90 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|