C24H36N8O3 — CID 10413054
4-N-cycloheptyl-6-N-(4-methoxy-3-nitrophenyl)-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 10413054) has the molecular formula C24H36N8O3 and a molecular weight of 484.61 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-N-(4-methoxy-3-nitrophenyl)-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-cycloheptyl-6-N-(4-methoxy-3-nitrophenyl)-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10413054 |
| Molecular Formula | C24H36N8O3 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 4-N-cycloheptyl-6-N-(4-methoxy-3-nitrophenyl)-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc(N(C)C3CCN(C)CC3)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H36N8O3/c1-30-14-12-19(13-15-30)31(2)24-28-22(25-17-8-6-4-5-7-9-17)27-23(29-24)26-18-10-11-21(35-3)20(16-18)32(33)34/h10-11,16-17,19H,4-9,12-15H2,1-3H3,(H2,25,26,27,28,29) |
| InChIKey | DXFQOJAPPKXIPT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|