C21H43O3PSn — CID 10413363
tributyl-[(1E,3E)-1-diethoxyphosphorylpenta-1,3-dienyl]stannane (PubChem CID 10413363) has the molecular formula C21H43O3PSn and a molecular weight of 493.26 g/mol. Its IUPAC name is tributyl-[(1E,3E)-1-diethoxyphosphorylpenta-1,3-dienyl]stannane.
| Compound Name | tributyl-[(1E,3E)-1-diethoxyphosphorylpenta-1,3-dienyl]stannane |
|---|---|
| PubChem CID | 10413363 |
| Molecular Formula | C21H43O3PSn |
| Molecular Weight | 493.26 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | tributyl-[(1E,3E)-1-diethoxyphosphorylpenta-1,3-dienyl]stannane |
| SMILES | C/C=C/C=C(\P(=O)(OCC)OCC)[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H16O3P.3C4H9.Sn/c1-4-7-8-9-13(10,11-5-2)12-6-3;3*1-3-4-2;/h4,7-8H,5-6H2,1-3H3;3*1,3-4H2,2H3;/b7-4+,9-8?;;;; |
| InChIKey | OOQYKHWSUSECHG-FEVLTMLISA-N |
| XLogP | 8.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.26 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|