C28H35N3O5 — CID 10413380
3-(1,3-benzodioxol-5-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoic acid (PubChem CID 10413380) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 10413380 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-4-[1-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butanoyl]piperidin-4-yl]butanoic acid |
| SMILES | O=C(O)CC(CC1CCN(C(=O)CCCc2ccc3c(n2)NCCC3)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H35N3O5/c32-26(5-1-4-23-8-6-20-3-2-12-29-28(20)30-23)31-13-10-19(11-14-31)15-22(17-27(33)34)21-7-9-24-25(16-21)36-18-35-24/h6-9,16,19,22H,1-5,10-15,17-18H2,(H,29,30)(H,33,34) |
| InChIKey | RPMQJDIFUVQKPJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |