C28H28N6O3 — CID 10413494
(2S,3R)-11,23-diamino-3-methoxy-2-methyl-4-(methylamino)-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8(13),9,11,14,19,21(26),22,24,27-nonaen-16-one (PubChem CID 10413494) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is (2S,3R)-11,23-diamino-3-methoxy-2-methyl-4-(methylamino)-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8(13),9,11,14,19,21(26),22,24,27-nonaen-16-one.
| Compound Name | (2S,3R)-11,23-diamino-3-methoxy-2-methyl-4-(methylamino)-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8(13),9,11,14,19,21(26),22,24,27-nonaen-16-one |
|---|---|
| PubChem CID | 10413494 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (2S,3R)-11,23-diamino-3-methoxy-2-methyl-4-(methylamino)-29-oxa-1,7,17-triazaoctacyclo[12.12.2.12,6.07,28.08,13.015,19.020,27.021,26]nonacosa-8(13),9,11,14,19,21(26),22,24,27-nonaen-16-one |
| SMILES | CNC1CC2O[C@@](C)([C@@H]1OC)n1c3ccc(N)cc3c3c4c(c5c6cc(N)ccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C28H28N6O3/c1-28-26(36-3)17(31-2)10-20(37-28)33-18-6-4-12(29)8-14(18)22-23-16(11-32-27(23)35)21-15-9-13(30)5-7-19(15)34(28)25(21)24(22)33/h4-9,17,20,26,31H,10-11,29-30H2,1-3H3,(H,32,35)/t17?,20?,26-,28+/m1/s1 |
| InChIKey | KEZGPXSYLNBZQN-COGAMNIMSA-N |
| XLogP | 3.52 |
| TPSA | 121.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|