C32H55N2O2+ — CID 10413622
[(2R,10S,13S,16S,17R)-10,13-dimethyl-16-(1-methylpiperidin-1-ium-1-yl)-2-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 10413622) has the molecular formula C32H55N2O2+ and a molecular weight of 499.80 g/mol. Its IUPAC name is [(2R,10S,13S,16S,17R)-10,13-dimethyl-16-(1-methylpiperidin-1-ium-1-yl)-2-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(2R,10S,13S,16S,17R)-10,13-dimethyl-16-(1-methylpiperidin-1-ium-1-yl)-2-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 10413622 |
| Molecular Formula | C32H55N2O2+ |
| Molecular Weight | 499.80 g/mol |
| Exact Mass | 499.43 |
| IUPAC Name | [(2R,10S,13S,16S,17R)-10,13-dimethyl-16-(1-methylpiperidin-1-ium-1-yl)-2-piperidin-1-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]([N+]2(C)CCCCC2)CC2C3CCC4CC[C@@H](N5CCCCC5)C[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C32H55N2O2/c1-23(35)36-30-29(34(4)19-9-6-10-20-34)21-28-26-14-12-24-11-13-25(33-17-7-5-8-18-33)22-32(24,3)27(26)15-16-31(28,30)2/h24-30H,5-22H2,1-4H3/q+1/t24?,25-,26?,27?,28?,29+,30+,31+,32+/m1/s1 |
| InChIKey | PIQRZGMOBHSAOQ-AVSCUQKLSA-N |
| XLogP | 6.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.80 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|