C30H40N4O3 — CID 10413809
methyl 6-amino-2-[[1-(4-phenylpentan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate (PubChem CID 10413809) has the molecular formula C30H40N4O3 and a molecular weight of 504.68 g/mol. Its IUPAC name is methyl 6-amino-2-[[1-(4-phenylpentan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-amino-2-[[1-(4-phenylpentan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 10413809 |
| Molecular Formula | C30H40N4O3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | methyl 6-amino-2-[[1-(4-phenylpentan-2-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
| SMILES | COC(=O)C(CCCCN)NC(=O)C1Cc2c([nH]c3ccccc23)C(C(C)CC(C)c2ccccc2)N1 |
| InChI | InChI=1S/C30H40N4O3/c1-19(21-11-5-4-6-12-21)17-20(2)27-28-23(22-13-7-8-14-24(22)32-28)18-26(33-27)29(35)34-25(30(36)37-3)15-9-10-16-31/h4-8,11-14,19-20,25-27,32-33H,9-10,15-18,31H2,1-3H3,(H,34,35) |
| InChIKey | DITRHPXYIYYFMY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|