C30H39N3O4 — CID 10413840
bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10413840) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10413840 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-pentyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCCCC1C(C(=O)OCCCc2cccnc2)=C(C)NC(C)=C1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C30H39N3O4/c1-4-5-6-15-26-27(29(34)36-18-9-13-24-11-7-16-31-20-24)22(2)33-23(3)28(26)30(35)37-19-10-14-25-12-8-17-32-21-25/h7-8,11-12,16-17,20-21,26,33H,4-6,9-10,13-15,18-19H2,1-3H3 |
| InChIKey | OLGXIFLJJKDZLJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|