C28H38N4O5 — CID 10413994
1-[2-methyl-6-[3-[4-(3,4,5-trimethoxyphenyl)imidazol-1-yl]propoxy]phenyl]-3-pentylurea (PubChem CID 10413994) has the molecular formula C28H38N4O5 and a molecular weight of 510.64 g/mol. Its IUPAC name is 1-[2-methyl-6-[3-[4-(3,4,5-trimethoxyphenyl)imidazol-1-yl]propoxy]phenyl]-3-pentylurea.
| Compound Name | 1-[2-methyl-6-[3-[4-(3,4,5-trimethoxyphenyl)imidazol-1-yl]propoxy]phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 10413994 |
| Molecular Formula | C28H38N4O5 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 1-[2-methyl-6-[3-[4-(3,4,5-trimethoxyphenyl)imidazol-1-yl]propoxy]phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1c(C)cccc1OCCCn1cnc(-c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H38N4O5/c1-6-7-8-13-29-28(33)31-26-20(2)11-9-12-23(26)37-15-10-14-32-18-22(30-19-32)21-16-24(34-3)27(36-5)25(17-21)35-4/h9,11-12,16-19H,6-8,10,13-15H2,1-5H3,(H2,29,31,33) |
| InChIKey | CIYKPMVNMHSZOP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 95.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|