C22H23F6NO4S — CID 10414013
4-[4-[5,5,6,6,6-pentafluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoic acid (PubChem CID 10414013) has the molecular formula C22H23F6NO4S and a molecular weight of 511.48 g/mol. Its IUPAC name is 4-[4-[5,5,6,6,6-pentafluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoic acid.
| Compound Name | 4-[4-[5,5,6,6,6-pentafluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 10414013 |
| Molecular Formula | C22H23F6NO4S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 4-[4-[5,5,6,6,6-pentafluoro-1-[(4-fluorophenyl)sulfonylamino]hexyl]phenyl]butanoic acid |
| SMILES | O=C(O)CCCc1ccc(C(CCCC(F)(F)C(F)(F)F)NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H23F6NO4S/c23-17-10-12-18(13-11-17)34(32,33)29-19(4-2-14-21(24,25)22(26,27)28)16-8-6-15(7-9-16)3-1-5-20(30)31/h6-13,19,29H,1-5,14H2,(H,30,31) |
| InChIKey | ZCGGCPCQTKPOSS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|