C29H41N3O5 — CID 10414034
3-[[4-[(8-tert-butyl-3-cyclohexyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl)methyl]benzoyl]amino]propanoic acid (PubChem CID 10414034) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is 3-[[4-[(8-tert-butyl-3-cyclohexyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl)methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(8-tert-butyl-3-cyclohexyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl)methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10414034 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | 3-[[4-[(8-tert-butyl-3-cyclohexyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl)methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC2(CC1)C(=O)N(C1CCCCC1)C(=O)N2Cc1ccc(C(=O)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C29H41N3O5/c1-28(2,3)22-13-16-29(17-14-22)26(36)32(23-7-5-4-6-8-23)27(37)31(29)19-20-9-11-21(12-10-20)25(35)30-18-15-24(33)34/h9-12,22-23H,4-8,13-19H2,1-3H3,(H,30,35)(H,33,34) |
| InChIKey | SPWOSOYVYBUNAA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|