C24H25FN6O4S — CID 10414057
(1R,3R,4R)-4-[(7-fluoro-3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]-3-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)cyclohexane-1-carboxamide (PubChem CID 10414057) has the molecular formula C24H25FN6O4S and a molecular weight of 512.57 g/mol. Its IUPAC name is (1R,3R,4R)-4-[(7-fluoro-3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]-3-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)cyclohexane-1-carboxamide.
| Compound Name | (1R,3R,4R)-4-[(7-fluoro-3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]-3-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10414057 |
| Molecular Formula | C24H25FN6O4S |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | (1R,3R,4R)-4-[(7-fluoro-3-oxo-4H-pyrido[3,2-b][1,4]thiazin-6-yl)methylamino]-3-hydroxy-N-(6-methoxy-1,5-naphthyridin-4-yl)cyclohexane-1-carboxamide |
| SMILES | COc1ccc2nccc(NC(=O)[C@@H]3CC[C@@H](NCc4nc5c(cc4F)SCC(=O)N5)[C@H](O)C3)c2n1 |
| InChI | InChI=1S/C24H25FN6O4S/c1-35-21-5-4-15-22(31-21)16(6-7-26-15)29-24(34)12-2-3-14(18(32)8-12)27-10-17-13(25)9-19-23(28-17)30-20(33)11-36-19/h4-7,9,12,14,18,27,32H,2-3,8,10-11H2,1H3,(H,26,29,34)(H,28,30,33)/t12-,14-,18-/m1/s1 |
| InChIKey | CYHZYFWBZFKFHI-RVZJWNSFSA-N |
| XLogP | 2.47 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |