C25H34F3N3O5 — CID 10414086
[(1S,3R)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone (PubChem CID 10414086) has the molecular formula C25H34F3N3O5 and a molecular weight of 513.56 g/mol. Its IUPAC name is [(1S,3R)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone.
| Compound Name | [(1S,3R)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
|---|---|
| PubChem CID | 10414086 |
| Molecular Formula | C25H34F3N3O5 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [(1S,3R)-3-[(3-methoxyoxan-4-yl)amino]-1-propan-2-ylcyclopentyl]-[5-nitro-7-(trifluoromethyl)-3,4-dihydro-1H-isoquinolin-2-yl]methanone |
| SMILES | COC1COCCC1N[C@@H]1CC[C@@](C(=O)N2CCc3c(cc(C(F)(F)F)cc3[N+](=O)[O-])C2)(C(C)C)C1 |
| InChI | InChI=1S/C25H34F3N3O5/c1-15(2)24(7-4-18(12-24)29-20-6-9-36-14-22(20)35-3)23(32)30-8-5-19-16(13-30)10-17(25(26,27)28)11-21(19)31(33)34/h10-11,15,18,20,22,29H,4-9,12-14H2,1-3H3/t18-,20?,22?,24+/m1/s1 |
| InChIKey | COIKXUITUVGOHN-QTEUNZJDSA-N |
| XLogP | 4.09 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|