C30H31ClN2O4 — CID 10414289
(E)-N-[(4R,4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7a-methyl-7-oxo-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 10414289) has the molecular formula C30H31ClN2O4 and a molecular weight of 519.04 g/mol. Its IUPAC name is (E)-N-[(4R,4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7a-methyl-7-oxo-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4R,4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7a-methyl-7-oxo-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 10414289 |
| Molecular Formula | C30H31ClN2O4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (E)-N-[(4R,4aS,7aR,12bR)-3-(cyclopropylmethyl)-9-hydroxy-7a-methyl-7-oxo-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-yl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | C[C@@]12Oc3c(O)ccc4c3[C@@]13CCN(CC1CC1)[C@H](C4)[C@]3(NC(=O)/C=C/c1ccc(Cl)cc1)CCC2=O |
| InChI | InChI=1S/C30H31ClN2O4/c1-28-24(35)12-13-30(32-25(36)11-6-18-4-8-21(31)9-5-18)23-16-20-7-10-22(34)27(37-28)26(20)29(28,30)14-15-33(23)17-19-2-3-19/h4-11,19,23,34H,2-3,12-17H2,1H3,(H,32,36)/b11-6+/t23-,28+,29+,30-/m1/s1 |
| InChIKey | AXCPDBZOMUJPPB-MTDQOHCRSA-N |
| XLogP | 4.41 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|