C27H30F3NO6 — CID 10414361
[(2S,4R)-2,4-dimethyl-5-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-5-oxopentyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10414361) has the molecular formula C27H30F3NO6 and a molecular weight of 521.53 g/mol. Its IUPAC name is [(2S,4R)-2,4-dimethyl-5-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-5-oxopentyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2S,4R)-2,4-dimethyl-5-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-5-oxopentyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10414361 |
| Molecular Formula | C27H30F3NO6 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [(2S,4R)-2,4-dimethyl-5-[(4S,5R)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-5-oxopentyl] 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | COC(C(=O)OC[C@@H](C)C[C@@H](C)C(=O)N1C(=O)O[C@H](c2ccccc2)[C@@H]1C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H30F3NO6/c1-17(16-36-24(33)26(35-4,27(28,29)30)21-13-9-6-10-14-21)15-18(2)23(32)31-19(3)22(37-25(31)34)20-11-7-5-8-12-20/h5-14,17-19,22H,15-16H2,1-4H3/t17-,18+,19-,22-,26?/m0/s1 |
| InChIKey | HXQMBWWEMIQJFT-GFARKPMHSA-N |
| XLogP | 5.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |