C30H39N3O3S — CID 10414380
N-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-2-pyridin-2-ylacetamide (PubChem CID 10414380) has the molecular formula C30H39N3O3S and a molecular weight of 521.73 g/mol. Its IUPAC name is N-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 10414380 |
| Molecular Formula | C30H39N3O3S |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | N-[(1S,2S,4R)-7,7-dimethyl-1-(spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylsulfonylmethyl)-2-bicyclo[2.2.1]heptanyl]-2-pyridin-2-ylacetamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)N1CCC3(CCc4ccccc43)CC1)[C@@H](NC(=O)Cc1ccccn1)C2 |
| InChI | InChI=1S/C30H39N3O3S/c1-28(2)23-11-13-30(28,26(19-23)32-27(34)20-24-8-5-6-16-31-24)21-37(35,36)33-17-14-29(15-18-33)12-10-22-7-3-4-9-25(22)29/h3-9,16,23,26H,10-15,17-21H2,1-2H3,(H,32,34)/t23-,26+,30-/m1/s1 |
| InChIKey | GPHPGBKCXLZEMD-RHSVSJCASA-N |
| XLogP | 4.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |