C22H21F6NO5S — CID 10414493
4-[4-[2-fluoro-4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 10414493) has the molecular formula C22H21F6NO5S and a molecular weight of 525.47 g/mol. Its IUPAC name is 4-[4-[2-fluoro-4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[2-fluoro-4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 10414493 |
| Molecular Formula | C22H21F6NO5S |
| Molecular Weight | 525.47 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | 4-[4-[2-fluoro-4-(3,3,4,4,4-pentafluorobutyl)phenyl]phenyl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)c2ccc(-c3ccc(CCC(F)(F)C(F)(F)F)cc3F)cc2)CCOCC1 |
| InChI | InChI=1S/C22H21F6NO5S/c23-18-13-14(7-8-21(24,25)22(26,27)28)1-6-17(18)15-2-4-16(5-3-15)35(32,33)20(19(30)29-31)9-11-34-12-10-20/h1-6,13,31H,7-12H2,(H,29,30) |
| InChIKey | QUQYAUVGUDJEHQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|