C28H40O6S2 — CID 10414833
(4R)-4-[(1R,2S)-3,3-bis(ethylsulfanyl)-1,2-bis[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10414833) has the molecular formula C28H40O6S2 and a molecular weight of 536.76 g/mol. Its IUPAC name is (4R)-4-[(1R,2S)-3,3-bis(ethylsulfanyl)-1,2-bis[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(1R,2S)-3,3-bis(ethylsulfanyl)-1,2-bis[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10414833 |
| Molecular Formula | C28H40O6S2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | (4R)-4-[(1R,2S)-3,3-bis(ethylsulfanyl)-1,2-bis[(4-methoxyphenyl)methoxy]propyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCSC(SCC)[C@@H](OCc1ccc(OC)cc1)[C@H](OCc1ccc(OC)cc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C28H40O6S2/c1-7-35-27(36-8-2)26(32-18-21-11-15-23(30-6)16-12-21)25(24-19-33-28(3,4)34-24)31-17-20-9-13-22(29-5)14-10-20/h9-16,24-27H,7-8,17-19H2,1-6H3/t24-,25-,26+/m1/s1 |
| InChIKey | OCJWUFOSFUFSQG-CYXNTTPDSA-N |
| XLogP | 6.16 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|