C35H55NO3 — CID 10414847
[4-hydroxy-3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] 2-(dimethylamino)acetate (PubChem CID 10414847) has the molecular formula C35H55NO3 and a molecular weight of 537.83 g/mol. Its IUPAC name is [4-hydroxy-3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] 2-(dimethylamino)acetate.
| Compound Name | [4-hydroxy-3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 10414847 |
| Molecular Formula | C35H55NO3 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 537.42 |
| IUPAC Name | [4-hydroxy-3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalen-1-yl] 2-(dimethylamino)acetate |
| SMILES | C/C(=C\Cc1c(C)c(O)c2ccccc2c1OC(=O)CN(C)C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C35H55NO3/c1-25(2)14-11-15-26(3)16-12-17-27(4)18-13-19-28(5)22-23-30-29(6)34(38)31-20-9-10-21-32(31)35(30)39-33(37)24-36(7)8/h9-10,20-22,25-27,38H,11-19,23-24H2,1-8H3/b28-22+ |
| InChIKey | WAKQCIVFRYDPCM-XAYXJRQQSA-N |
| XLogP | 9.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|