C32H35N3O5 — CID 10414953
2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-6,8-bis(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate (PubChem CID 10414953) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-6,8-bis(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-6,8-bis(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 10414953 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (6S,9aS)-4,7-dioxo-6,8-bis(2-phenylethyl)-3,6,9,9a-tetrahydro-2H-pyrazino[1,2-a]pyrimidine-1-carboxylate |
| SMILES | O=C1[C@H](CCc2ccccc2)N2C(=O)CCN(C(=O)OCCc3ccc(O)cc3)[C@H]2CN1CCc1ccccc1 |
| InChI | InChI=1S/C32H35N3O5/c36-27-14-11-26(12-15-27)19-22-40-32(39)34-21-18-30(37)35-28(16-13-24-7-3-1-4-8-24)31(38)33(23-29(34)35)20-17-25-9-5-2-6-10-25/h1-12,14-15,28-29,36H,13,16-23H2/t28-,29+/m0/s1 |
| InChIKey | LXHWXSOPYIHKPE-URLMMPGGSA-N |
| XLogP | 4.02 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |