C27H23BrF3N3O — CID 10414960
2-(4-bromophenyl)-6-(pyrrolidin-1-ylmethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol (PubChem CID 10414960) has the molecular formula C27H23BrF3N3O and a molecular weight of 542.40 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-(pyrrolidin-1-ylmethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol.
| Compound Name | 2-(4-bromophenyl)-6-(pyrrolidin-1-ylmethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 10414960 |
| Molecular Formula | C27H23BrF3N3O |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 2-(4-bromophenyl)-6-(pyrrolidin-1-ylmethyl)-4-[[7-(trifluoromethyl)quinolin-4-yl]amino]phenol |
| SMILES | Oc1c(CN2CCCC2)cc(Nc2ccnc3cc(C(F)(F)F)ccc23)cc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H23BrF3N3O/c28-20-6-3-17(4-7-20)23-15-21(13-18(26(23)35)16-34-11-1-2-12-34)33-24-9-10-32-25-14-19(27(29,30)31)5-8-22(24)25/h3-10,13-15,35H,1-2,11-12,16H2,(H,32,33) |
| InChIKey | RDNLTSULJPQATG-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|