About N,6-dimethylheptan-2-amine
N,6-dimethylheptan-2-amine (PubChem CID 10415) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is N,6-dimethylheptan-2-amine.
Molecular Properties
| Compound Name | N,6-dimethylheptan-2-amine |
| PubChem CID | 10415 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | N,6-dimethylheptan-2-amine |
| SMILES | CNC(C)CCCC(C)C |
| InChI | InChI=1S/C9H21N/c1-8(2)6-5-7-9(3)10-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | KYMRGVJAIFPUPQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,6-dimethylheptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethylheptan-2-amine?
The IUPAC name of N,6-dimethylheptan-2-amine (CID 10415) is N,6-dimethylheptan-2-amine.
What is the SMILES notation for N,6-dimethylheptan-2-amine?
The canonical SMILES for N,6-dimethylheptan-2-amine is CNC(C)CCCC(C)C.
What is the InChIKey of N,6-dimethylheptan-2-amine?
The InChIKey is KYMRGVJAIFPUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N/c1-8(2)6-5-7-9(3)10-4/h8-10H,5-7H2,1-4H3.
What are the key properties of N,6-dimethylheptan-2-amine?
N,6-dimethylheptan-2-amine has a molecular weight of 143.27 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethylheptan-2-amine is sourced from PubChem (CID 10415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).