C27H23F4N3O3S — CID 10415033
(2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(2R,3R)-2-(2,5-difluorophenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]propanamide (PubChem CID 10415033) has the molecular formula C27H23F4N3O3S and a molecular weight of 545.56 g/mol. Its IUPAC name is (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(2R,3R)-2-(2,5-difluorophenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]propanamide.
| Compound Name | (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(2R,3R)-2-(2,5-difluorophenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]propanamide |
|---|---|
| PubChem CID | 10415033 |
| Molecular Formula | C27H23F4N3O3S |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | (2S)-2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-[(2R,3R)-2-(2,5-difluorophenyl)-5-methyl-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]propanamide |
| SMILES | C[C@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)N[C@@H]1C(=O)N(C)c2ccccc2S[C@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C27H23F4N3O3S/c1-14(32-23(35)11-15-9-17(29)12-18(30)10-15)26(36)33-24-25(19-13-16(28)7-8-20(19)31)38-22-6-4-3-5-21(22)34(2)27(24)37/h3-10,12-14,24-25H,11H2,1-2H3,(H,32,35)(H,33,36)/t14-,24-,25-/m0/s1 |
| InChIKey | GBMGKOBAKFBJJS-JREXYNDVSA-N |
| XLogP | 4.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |