C29H52O8Si — CID 10415330
[(3S,3aR,4S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1,2,3,3a,4,7,8,8a-octahydroazulen-4-yl] (3S)-5-(1,3-dioxolan-2-yl)-3-methylpentanoate (PubChem CID 10415330) has the molecular formula C29H52O8Si and a molecular weight of 556.81 g/mol. Its IUPAC name is [(3S,3aR,4S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1,2,3,3a,4,7,8,8a-octahydroazulen-4-yl] (3S)-5-(1,3-dioxolan-2-yl)-3-methylpentanoate.
| Compound Name | [(3S,3aR,4S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1,2,3,3a,4,7,8,8a-octahydroazulen-4-yl] (3S)-5-(1,3-dioxolan-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 10415330 |
| Molecular Formula | C29H52O8Si |
| Molecular Weight | 556.81 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | [(3S,3aR,4S,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-3-(2-methoxyethoxymethoxy)-1,2,3,3a,4,7,8,8a-octahydroazulen-4-yl] (3S)-5-(1,3-dioxolan-2-yl)-3-methylpentanoate |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1[C@@H](OC(=O)C[C@@H](C)CCC1OCCO1)C=CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H52O8Si/c1-21(11-14-27-33-17-18-34-27)19-26(30)36-25-10-8-9-23(37-38(6,7)29(2,3)4)22-12-13-24(28(22)25)35-20-32-16-15-31-5/h8,10,21-25,27-28H,9,11-20H2,1-7H3/t21-,22-,23-,24-,25-,28+/m0/s1 |
| InChIKey | ZIFGIPYSMBVTFG-GYZOGRGXSA-N |
| XLogP | 5.46 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|