C15H10Cl2N2OS2 — CID 1041589
2,4-dichloro-6-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)iminomethyl]phenol (PubChem CID 1041589) has the molecular formula C15H10Cl2N2OS2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 2,4-dichloro-6-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)iminomethyl]phenol.
| Compound Name | 2,4-dichloro-6-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 1041589 |
| Molecular Formula | C15H10Cl2N2OS2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 2,4-dichloro-6-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)iminomethyl]phenol |
| SMILES | CSc1nc2ccc(/N=C/c3cc(Cl)cc(Cl)c3O)cc2s1 |
| InChI | InChI=1S/C15H10Cl2N2OS2/c1-21-15-19-12-3-2-10(6-13(12)22-15)18-7-8-4-9(16)5-11(17)14(8)20/h2-7,20H,1H3/b18-7+ |
| InChIKey | PCRSUCNCNNSBPB-CNHKJKLMSA-N |
| XLogP | 5.78 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|