C35H43F2N5O4S — CID 10417008
[(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[2-(2-methylpropyl)-1,3-thiazol-5-yl]methylamino]butan-2-yl] 3-(dipropylcarbamoyl)-5-(1,3-oxazol-2-yl)benzoate (PubChem CID 10417008) has the molecular formula C35H43F2N5O4S and a molecular weight of 667.82 g/mol. Its IUPAC name is [(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[2-(2-methylpropyl)-1,3-thiazol-5-yl]methylamino]butan-2-yl] 3-(dipropylcarbamoyl)-5-(1,3-oxazol-2-yl)benzoate.
| Compound Name | [(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[2-(2-methylpropyl)-1,3-thiazol-5-yl]methylamino]butan-2-yl] 3-(dipropylcarbamoyl)-5-(1,3-oxazol-2-yl)benzoate |
|---|---|
| PubChem CID | 10417008 |
| Molecular Formula | C35H43F2N5O4S |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | [(2R,3S)-3-amino-4-(3,5-difluorophenyl)-1-[[2-(2-methylpropyl)-1,3-thiazol-5-yl]methylamino]butan-2-yl] 3-(dipropylcarbamoyl)-5-(1,3-oxazol-2-yl)benzoate |
| SMILES | CCCN(CCC)C(=O)c1cc(C(=O)O[C@H](CNCc2cnc(CC(C)C)s2)[C@@H](N)Cc2cc(F)cc(F)c2)cc(-c2ncco2)c1 |
| InChI | InChI=1S/C35H43F2N5O4S/c1-5-8-42(9-6-2)34(43)25-15-24(33-40-7-10-45-33)16-26(17-25)35(44)46-31(30(38)14-23-12-27(36)18-28(37)13-23)21-39-19-29-20-41-32(47-29)11-22(3)4/h7,10,12-13,15-18,20,22,30-31,39H,5-6,8-9,11,14,19,21,38H2,1-4H3/t30-,31+/m0/s1 |
| InChIKey | OGUOOBJJTGCHDT-IOWSJCHKSA-N |
| XLogP | 6.42 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |