C30H39NO16 — CID 10417025
[(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(1S,4R,5S,6S)-4,5,6-triacetyloxy-3-(acetyloxymethyl)cyclohex-2-en-1-yl]amino]cyclohexen-1-yl]methyl acetate (PubChem CID 10417025) has the molecular formula C30H39NO16 and a molecular weight of 669.63 g/mol. Its IUPAC name is [(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(1S,4R,5S,6S)-4,5,6-triacetyloxy-3-(acetyloxymethyl)cyclohex-2-en-1-yl]amino]cyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(1S,4R,5S,6S)-4,5,6-triacetyloxy-3-(acetyloxymethyl)cyclohex-2-en-1-yl]amino]cyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10417025 |
| Molecular Formula | C30H39NO16 |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | [(3S,4S,5S,6R)-4,5,6-triacetyloxy-3-[[(1S,4R,5S,6S)-4,5,6-triacetyloxy-3-(acetyloxymethyl)cyclohex-2-en-1-yl]amino]cyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@H](NC2C=C(COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H39NO16/c1-13(32)40-11-21-9-23(27(44-17(5)36)29(46-19(7)38)25(21)42-15(3)34)31-24-10-22(12-41-14(2)33)26(43-16(4)35)30(47-20(8)39)28(24)45-18(6)37/h9-10,23-31H,11-12H2,1-8H3/t23-,24?,25+,26+,27-,28-,29-,30-/m0/s1 |
| InChIKey | FHWQPSWYAPOYNY-RYYNKBHUSA-N |
| XLogP | -0.09 |
| TPSA | 222.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|