C58H50O10 — CID 10418292
methyl 2-[6-methoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate (PubChem CID 10418292) has the molecular formula C58H50O10 and a molecular weight of 907.03 g/mol. Its IUPAC name is methyl 2-[6-methoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate.
| Compound Name | methyl 2-[6-methoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate |
|---|---|
| PubChem CID | 10418292 |
| Molecular Formula | C58H50O10 |
| Molecular Weight | 907.03 g/mol |
| Exact Mass | 906.34 |
| IUPAC Name | methyl 2-[6-methoxycarbonyl-2,3,4-tris(phenylmethoxy)phenyl]-3,4,5-tris(phenylmethoxy)benzoate |
| SMILES | COC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1-c1c(C(=O)OC)cc(OCc2ccccc2)c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C58H50O10/c1-61-57(59)47-33-49(63-35-41-21-9-3-10-22-41)53(65-37-43-25-13-5-14-26-43)55(67-39-45-29-17-7-18-30-45)51(47)52-48(58(60)62-2)34-50(64-36-42-23-11-4-12-24-42)54(66-38-44-27-15-6-16-28-44)56(52)68-40-46-31-19-8-20-32-46/h3-34H,35-40H2,1-2H3 |
| InChIKey | HCCXLXLJWXVYIT-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.03 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |