About ethyl 2-methylpropanimidate
ethyl 2-methylpropanimidate (PubChem CID 10419153) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is ethyl 2-methylpropanimidate.
Molecular Properties
| Compound Name | ethyl 2-methylpropanimidate |
| PubChem CID | 10419153 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | ethyl 2-methylpropanimidate |
| SMILES | [H]/N=C(\OCC)C(C)C |
| InChI | InChI=1S/C6H13NO/c1-4-8-6(7)5(2)3/h5,7H,4H2,1-3H3/b7-6- |
| InChIKey | ZXZQXWVPGASIQP-SREVYHEPSA-N |
| XLogP | 1.66 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methylpropanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylpropanimidate?
The IUPAC name of ethyl 2-methylpropanimidate (CID 10419153) is ethyl 2-methylpropanimidate.
What is the SMILES notation for ethyl 2-methylpropanimidate?
The canonical SMILES for ethyl 2-methylpropanimidate is [H]/N=C(\OCC)C(C)C.
What is the InChIKey of ethyl 2-methylpropanimidate?
The InChIKey is ZXZQXWVPGASIQP-SREVYHEPSA-N. The full InChI is InChI=1S/C6H13NO/c1-4-8-6(7)5(2)3/h5,7H,4H2,1-3H3/b7-6-.
What are the key properties of ethyl 2-methylpropanimidate?
ethyl 2-methylpropanimidate has a molecular weight of 115.18 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylpropanimidate is sourced from PubChem (CID 10419153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).