About 2-pyridin-3-ylguanidine
2-pyridin-3-ylguanidine (PubChem CID 10419235) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 2-pyridin-3-ylguanidine.
Molecular Properties
| Compound Name | 2-pyridin-3-ylguanidine |
| PubChem CID | 10419235 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 2-pyridin-3-ylguanidine |
| SMILES | NC(N)=Nc1cccnc1 |
| InChI | InChI=1S/C6H8N4/c7-6(8)10-5-2-1-3-9-4-5/h1-4H,(H4,7,8,10) |
| InChIKey | UHLKYVNSNIWKGX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-3-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylguanidine?
The IUPAC name of 2-pyridin-3-ylguanidine (CID 10419235) is 2-pyridin-3-ylguanidine.
What is the SMILES notation for 2-pyridin-3-ylguanidine?
The canonical SMILES for 2-pyridin-3-ylguanidine is NC(N)=Nc1cccnc1.
What is the InChIKey of 2-pyridin-3-ylguanidine?
The InChIKey is UHLKYVNSNIWKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-6(8)10-5-2-1-3-9-4-5/h1-4H,(H4,7,8,10).
What are the key properties of 2-pyridin-3-ylguanidine?
2-pyridin-3-ylguanidine has a molecular weight of 136.16 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylguanidine is sourced from PubChem (CID 10419235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).