About 6-hydroxy-1,4-dimethylpiperidin-2-one
6-hydroxy-1,4-dimethylpiperidin-2-one (PubChem CID 10419299) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 6-hydroxy-1,4-dimethylpiperidin-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-1,4-dimethylpiperidin-2-one |
| PubChem CID | 10419299 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 6-hydroxy-1,4-dimethylpiperidin-2-one |
| SMILES | CC1CC(=O)N(C)C(O)C1 |
| InChI | InChI=1S/C7H13NO2/c1-5-3-6(9)8(2)7(10)4-5/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | MXUFQJPPJXFUJU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxy-1,4-dimethylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-1,4-dimethylpiperidin-2-one?
The IUPAC name of 6-hydroxy-1,4-dimethylpiperidin-2-one (CID 10419299) is 6-hydroxy-1,4-dimethylpiperidin-2-one.
What is the SMILES notation for 6-hydroxy-1,4-dimethylpiperidin-2-one?
The canonical SMILES for 6-hydroxy-1,4-dimethylpiperidin-2-one is CC1CC(=O)N(C)C(O)C1.
What is the InChIKey of 6-hydroxy-1,4-dimethylpiperidin-2-one?
The InChIKey is MXUFQJPPJXFUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-5-3-6(9)8(2)7(10)4-5/h5-6,9H,3-4H2,1-2H3.
What are the key properties of 6-hydroxy-1,4-dimethylpiperidin-2-one?
6-hydroxy-1,4-dimethylpiperidin-2-one has a molecular weight of 143.19 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-1,4-dimethylpiperidin-2-one is sourced from PubChem (CID 10419299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).