About 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol
1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol (PubChem CID 10419437) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
| PubChem CID | 10419437 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C8H14O3/c1-4-6(9)7-5-10-8(2,3)11-7/h4,6-7,9H,1,5H2,2-3H3/t6?,7-/m0/s1 |
| InChIKey | SGAHBTSLTNIYOK-MLWJPKLSSA-N |
| XLogP | 0.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol?
The IUPAC name of 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol (CID 10419437) is 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol.
What is the SMILES notation for 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol?
The canonical SMILES for 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol is C=CC(O)[C@@H]1COC(C)(C)O1.
What is the InChIKey of 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol?
The InChIKey is SGAHBTSLTNIYOK-MLWJPKLSSA-N. The full InChI is InChI=1S/C8H14O3/c1-4-6(9)7-5-10-8(2,3)11-7/h4,6-7,9H,1,5H2,2-3H3/t6?,7-/m0/s1.
What are the key properties of 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol?
1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol has a molecular weight of 158.20 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-en-1-ol is sourced from PubChem (CID 10419437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).