C8H14O3 — CID 10419438
(3R,4S,5R,6R)-4-hydroxy-3,5,6-trimethyloxan-2-one (PubChem CID 10419438) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-hydroxy-3,5,6-trimethyloxan-2-one.
| Compound Name | (3R,4S,5R,6R)-4-hydroxy-3,5,6-trimethyloxan-2-one |
|---|---|
| PubChem CID | 10419438 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3R,4S,5R,6R)-4-hydroxy-3,5,6-trimethyloxan-2-one |
| SMILES | C[C@@H]1[C@H](O)[C@@H](C)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C8H14O3/c1-4-6(3)11-8(10)5(2)7(4)9/h4-7,9H,1-3H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | WIPAYFJRYZXVMZ-WNJXEPBRSA-N |
| XLogP | 0.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |