About N-ethylpyrrolo[2,3-b]pyridin-1-amine
N-ethylpyrrolo[2,3-b]pyridin-1-amine (PubChem CID 10419482) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is N-ethylpyrrolo[2,3-b]pyridin-1-amine.
Molecular Properties
| Compound Name | N-ethylpyrrolo[2,3-b]pyridin-1-amine |
| PubChem CID | 10419482 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-ethylpyrrolo[2,3-b]pyridin-1-amine |
| SMILES | CCNn1ccc2cccnc21 |
| InChI | InChI=1S/C9H11N3/c1-2-11-12-7-5-8-4-3-6-10-9(8)12/h3-7,11H,2H2,1H3 |
| InChIKey | SFENHEDVUVKPKT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylpyrrolo[2,3-b]pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpyrrolo[2,3-b]pyridin-1-amine?
The IUPAC name of N-ethylpyrrolo[2,3-b]pyridin-1-amine (CID 10419482) is N-ethylpyrrolo[2,3-b]pyridin-1-amine.
What is the SMILES notation for N-ethylpyrrolo[2,3-b]pyridin-1-amine?
The canonical SMILES for N-ethylpyrrolo[2,3-b]pyridin-1-amine is CCNn1ccc2cccnc21.
What is the InChIKey of N-ethylpyrrolo[2,3-b]pyridin-1-amine?
The InChIKey is SFENHEDVUVKPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-2-11-12-7-5-8-4-3-6-10-9(8)12/h3-7,11H,2H2,1H3.
What are the key properties of N-ethylpyrrolo[2,3-b]pyridin-1-amine?
N-ethylpyrrolo[2,3-b]pyridin-1-amine has a molecular weight of 161.21 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpyrrolo[2,3-b]pyridin-1-amine is sourced from PubChem (CID 10419482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).