(2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid

C8H10O4 — CID 10419592

IUPAC(2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid
SMILESO=C(O)/C=C1\C(=O)CCCC1O
InChIInChI=1S/C8H10O4/c9-6-2-1-3-7(10)5(6)4-8(11)12/h4,6,9H,1-3H2,(H,11,12)/b5-4-
InChIKeyWLRHSBRTBPYXQG-PLNGDYQASA-N
MW170.16 g/mol
LogP0.11
Rot. Bonds1

About (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid

(2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid (PubChem CID 10419592) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid.

Molecular Properties

Compound Name(2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid
PubChem CID10419592
Molecular FormulaC8H10O4
Molecular Weight170.16 g/mol
Exact Mass170.06
IUPAC Name(2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid
SMILESO=C(O)/C=C1\C(=O)CCCC1O
InChIInChI=1S/C8H10O4/c9-6-2-1-3-7(10)5(6)4-8(11)12/h4,6,9H,1-3H2,(H,11,12)/b5-4-
InChIKeyWLRHSBRTBPYXQG-PLNGDYQASA-N
XLogP0.11
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.16
LogP ≤ 50.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid?
The IUPAC name of (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid (CID 10419592) is (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid.
What is the SMILES notation for (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid?
The canonical SMILES for (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid is O=C(O)/C=C1\C(=O)CCCC1O.
What is the InChIKey of (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid?
The InChIKey is WLRHSBRTBPYXQG-PLNGDYQASA-N. The full InChI is InChI=1S/C8H10O4/c9-6-2-1-3-7(10)5(6)4-8(11)12/h4,6,9H,1-3H2,(H,11,12)/b5-4-.
What are the key properties of (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid?
(2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid has a molecular weight of 170.16 g/mol, XLogP of 0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(2-hydroxy-6-oxocyclohexylidene)acetic acid is sourced from PubChem (CID 10419592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).