About 1-thia-4,8-diazaspiro[4.5]decan-3-one
1-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 10419642) has the molecular formula C7H12N2OS
and a molecular weight of 172.25 g/mol. Its IUPAC name is 1-thia-4,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 1-thia-4,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 10419642 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 1-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | O=C1CSC2(CCNCC2)N1 |
| InChI | InChI=1S/C7H12N2OS/c10-6-5-11-7(9-6)1-3-8-4-2-7/h8H,1-5H2,(H,9,10) |
| InChIKey | ZRYXFTYZSNHVDQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-thia-4,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thia-4,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of 1-thia-4,8-diazaspiro[4.5]decan-3-one (CID 10419642) is 1-thia-4,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for 1-thia-4,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for 1-thia-4,8-diazaspiro[4.5]decan-3-one is O=C1CSC2(CCNCC2)N1.
What is the InChIKey of 1-thia-4,8-diazaspiro[4.5]decan-3-one?
The InChIKey is ZRYXFTYZSNHVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS/c10-6-5-11-7(9-6)1-3-8-4-2-7/h8H,1-5H2,(H,9,10).
What are the key properties of 1-thia-4,8-diazaspiro[4.5]decan-3-one?
1-thia-4,8-diazaspiro[4.5]decan-3-one has a molecular weight of 172.25 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thia-4,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 10419642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).